CAS 2230802-48-7 appears in our catalog under these names: 4-(tert-Butoxycarbonyl)-1,4-thiazepane-6-carboxylic acid 1,1-dioxide, 97%, Tetrahydro-1,​4-​thiazepine-​4,​6(5H)​-​dicarboxylic acid 4-​(1,​1-​dimethylethyl) ester 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazepane-6-carboxylic acid (CAS 2230802-48-7) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazepane-6-carboxylic acid. InChIKey: HPTDFNPGWXZMAA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazepane-6-carboxylic acid |
| InChIKey | HPTDFNPGWXZMAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC(C1)C(=O)O |
Computed by PubChem (NCBI)