CAS 1783603-67-7 is the registry number for 2-(4-(Tert-Butoxycarbonyl)-1,1-dioxidothiomorpholin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid (CAS 1783603-67-7) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid. InChIKey: ZFZPIEHEEMGHEZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid |
| InChIKey | ZFZPIEHEEMGHEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)C(C1)CC(=O)O |
Computed by PubChem (NCBI)