CAS 929047-22-3 appears in our catalog under these names: 4-(tert-Butyl) 3-methyl thiomorpholine-3,4-dicarboxylate 1,1-dioxide, 98%, 4-tert-Butyl 3-methyl 1,1-dioxo-1λâ¶-thiomorpholine-3,4-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
4-O-tert-butyl 3-O-methyl 1,1-dioxo-1,4-thiazinane-3,4-dicarboxylate (CAS 929047-22-3) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl 1,1-dioxo-1,4-thiazinane-3,4-dicarboxylate. InChIKey: DIYIRNCLLFDDON-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 4-O-tert-butyl 3-O-methyl 1,1-dioxo-1,4-thiazinane-3,4-dicarboxylate |
| InChIKey | DIYIRNCLLFDDON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC1C(=O)OC |
Computed by PubChem (NCBI)