CAS 1542480-23-8 appears in our catalog under these names: 2-(4-(tert-Butoxycarbonyl)-1,1-dioxidothiomorpholin-3-yl)acetic acid, 95%, 2-{4-((tert-Butoxy)carbonyl)-1,1-dioxo-1λâ¶-thiomorpholin-3-yl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (CAS 1542480-23-8) is a chemical compound with the molecular formula C11H19NO6S and a molecular weight of 293.34 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid. InChIKey: HDAFQAXCMTZZBY-UHFFFAOYSA-N.
| Molecular formula | C11H19NO6S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| InChIKey | HDAFQAXCMTZZBY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC1CC(=O)O |
Computed by PubChem (NCBI)