CAS 191608-09-0 appears in our catalog under these names: 6-Chloro-chroman-4-ylamine hydrochloride, 6-Chlorochroman-4-amine hydrochloride, 98%, 98%, 6-Chlorochroman-4-amine hydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 191608-09-0) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: ARFUFGWFRJZAHS-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | ARFUFGWFRJZAHS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)