Products 1257901-69-1
CAS 1257901-69-1 is the registry number for 1-Oxo-1H,2H-pyrrolo(1,2-c)pyrimidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-oxo-2H-pyrrolo[1,2-c]pyrimidine-3-carboxylic acid (CAS 1257901-69-1) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 1-oxo-2H-pyrrolo[1,2-c]pyrimidine-3-carboxylic acid. InChIKey: FCHLMUTYELRQQC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 1-oxo-2H-pyrrolo[1,2-c]pyrimidine-3-carboxylic acid |
| InChIKey | FCHLMUTYELRQQC-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C=C(NC2=O)C(=O)O |
Computed by PubChem (NCBI)