CAS 1257982-95-8 is the registry number for 9-Phenyl-9H-carbazol-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
9-phenylcarbazol-2-amine (CAS 1257982-95-8) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 9-phenylcarbazol-2-amine. InChIKey: RUHPJRFOBUHYIQ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 9-phenylcarbazol-2-amine |
| InChIKey | RUHPJRFOBUHYIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4=C2C=C(C=C4)N |
Computed by PubChem (NCBI)