Products 374710-55-1
CAS 374710-55-1 is the registry number for 1-(p-Tolyl)-9H-pyrido(3,4-b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1-(4-methylphenyl)-9H-pyrido[3,4-b]indole (CAS 374710-55-1) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 1-(4-methylphenyl)-9H-pyrido[3,4-b]indole. InChIKey: GGJSVCXTVPWRBQ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)-9H-pyrido[3,4-b]indole |
| InChIKey | GGJSVCXTVPWRBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=CC3=C2NC4=CC=CC=C34 |
Computed by PubChem (NCBI)