CAS 858267-66-0 is the registry number for 1,2,3,6,7,8-Hexahydropyrene-4,9-dicarbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,6,7,8-hexahydropyrene-4,9-dicarbonitrile (CAS 858267-66-0) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 1,2,3,6,7,8-hexahydropyrene-4,9-dicarbonitrile. InChIKey: MADBSRYREUMDJR-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 1,2,3,6,7,8-hexahydropyrene-4,9-dicarbonitrile |
| InChIKey | MADBSRYREUMDJR-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C3CCCC4=CC(=C(C1)C2=C43)C#N)C#N |
Computed by PubChem (NCBI)