CAS 49662-17-1 is the registry number for 5-Phenyl-5,10-dihydrophenazine. Offered by: Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 50g.
10-phenyl-5H-phenazine (CAS 49662-17-1) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 10-phenyl-5H-phenazine. InChIKey: JGGSOWGJMBNDHS-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 10-phenyl-5H-phenazine |
| InChIKey | JGGSOWGJMBNDHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3NC4=CC=CC=C42 |
Computed by PubChem (NCBI)