Products 1318253-36-9
CAS 1318253-36-9 appears in our catalog under these names: 9–Phenyl–carbazol–3–amine, 9-Phenyl-9H-carbazol-3-amine 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100g, 1g, 5g, 25g.
9-phenylcarbazol-3-amine (CAS 1318253-36-9) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 9-phenylcarbazol-3-amine. InChIKey: MSAUMAWVSPLISW-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 9-phenylcarbazol-3-amine |
| InChIKey | MSAUMAWVSPLISW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)N)C4=CC=CC=C42 |
Computed by PubChem (NCBI)