CAS 16765-80-3 is the registry number for 1–Benzyl–9H––carboline. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
1-benzyl-9H-pyrido[3,4-b]indole (CAS 16765-80-3) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 1-benzyl-9H-pyrido[3,4-b]indole. InChIKey: UFTOXAVFYNUDSM-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 1-benzyl-9H-pyrido[3,4-b]indole |
| InChIKey | UFTOXAVFYNUDSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC=CC3=C2NC4=CC=CC=C34 |
Computed by PubChem (NCBI)