CAS 1259578-15-8 is the registry number for Carbidopa Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (CAS 1259578-15-8) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: methyl (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate. InChIKey: MKFJJXIMFTXSEM-LLVKDONJSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| InChIKey | MKFJJXIMFTXSEM-LLVKDONJSA-N |
| SMILES | C[C@@](CC1=CC(=C(C=C1)O)O)(C(=O)OC)N |
Computed by PubChem (NCBI)