CAS 158190-23-9 is the registry number for 3-Hydroxy-Alpha-methyl-tyrosine Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 50mg, 5mg.
Methyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (CAS 158190-23-9) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: methyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate. InChIKey: MKFJJXIMFTXSEM-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | methyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate |
| InChIKey | MKFJJXIMFTXSEM-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)(C(=O)OC)N |
Computed by PubChem (NCBI)