Products 158190-23-9

CAS 158190-23-9 is the registry number for 3-Hydroxy-Alpha-methyl-tyrosine Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 50mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate (CAS 158190-23-9) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: methyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate. InChIKey: MKFJJXIMFTXSEM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO4
Molecular weight225.24 g/mol
IUPAC namemethyl 2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoate
InChIKeyMKFJJXIMFTXSEM-UHFFFAOYSA-N
SMILESCC(CC1=CC(=C(C=C1)O)O)(C(=O)OC)N

Computed by PubChem (NCBI)