CAS 1259803-58-1 is the registry number for (R)-7-Nitro-5-(pyrrolidin-2-yl)-2,3-dihydro-1H-inden-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-nitro-5-[(2R)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-4-ol (CAS 1259803-58-1) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 7-nitro-5-[(2R)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-4-ol. InChIKey: BWQPPOGQVURNSP-LLVKDONJSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 7-nitro-5-[(2R)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-4-ol |
| InChIKey | BWQPPOGQVURNSP-LLVKDONJSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=C3CCCC3=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)