Products 125983-34-8
CAS 125983-34-8 is the registry number for 2-(Chloromethyl)-1H-perimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(chloromethyl)-1H-perimidine;hydrochloride (CAS 125983-34-8) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 2-(chloromethyl)-1H-perimidine;hydrochloride. InChIKey: VDPGJYUNPDJHCI-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 2-(chloromethyl)-1H-perimidine;hydrochloride |
| InChIKey | VDPGJYUNPDJHCI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)NC(=NC3=CC=C2)CCl.Cl |
Computed by PubChem (NCBI)