CAS 586409-04-3 is the registry number for 6-Bromo-2-(methylthio)oxazolo[4,5-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-methylsulfanyl-[1,3]oxazolo[4,5-b]pyridine (CAS 586409-04-3) is a chemical compound with the molecular formula C7H5BrN2OS and a molecular weight of 245.10 g/mol. IUPAC name: 6-bromo-2-methylsulfanyl-[1,3]oxazolo[4,5-b]pyridine. InChIKey: RNQHSUZOLSMWFZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2OS |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 6-bromo-2-methylsulfanyl-[1,3]oxazolo[4,5-b]pyridine |
| InChIKey | RNQHSUZOLSMWFZ-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(O1)C=C(C=N2)Br |
Computed by PubChem (NCBI)