CAS 1260011-24-2 is the registry number for 8-Chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-chloro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one (CAS 1260011-24-2) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 8-chloro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: ITCQVGVXUWEVQF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 8-chloro-7-methoxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | ITCQVGVXUWEVQF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCCC2=O)C=C1)Cl |
Computed by PubChem (NCBI)