Products 1260012-87-0
CAS 1260012-87-0 is the registry number for 6-Bromo-8-(trifluoromethyl)chroman-4-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
6-bromo-8-(trifluoromethyl)-2,3-dihydrochromen-4-one (CAS 1260012-87-0) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: 6-bromo-8-(trifluoromethyl)-2,3-dihydrochromen-4-one. InChIKey: COPJYWNPLSWIKU-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 6-bromo-8-(trifluoromethyl)-2,3-dihydrochromen-4-one |
| InChIKey | COPJYWNPLSWIKU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2C(F)(F)F)Br |
Computed by PubChem (NCBI)