Products 545395-64-0
CAS 545395-64-0 is the registry number for (E)-3-(2-Bromo-4-(trifluoromethyl)phenyl)acrylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[2-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 545395-64-0) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: (E)-3-[2-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: ZAMMHCGHYXQSDL-DUXPYHPUSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | (E)-3-[2-bromo-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | ZAMMHCGHYXQSDL-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)