CAS 23975-64-6 is the registry number for 1-(3-Bromophenyl)-4,4,4-trifluorobutane-1,3-dione, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
1-(3-bromophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 23975-64-6) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: 1-(3-bromophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: LGJKDRDJPDRKEX-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 1-(3-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | LGJKDRDJPDRKEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)