CAS 18931-61-8 appears in our catalog under these names: 1–(4–Bromophenyl)–4,4,4–trifluorobutane–1,3–dione, 1-(4-Bromophenyl)-4,4,4-trifluorobutane-1,3-dione, 96%, 96%, 1-(4-Bromo-phenyl)-4,4,4-trifluoro-butane-1,3-dione, 97%, 1-(4-Bromophenyl)-4,4,4-trifluorobutane-1,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 18931-61-8) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: 1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: ITVIRNOCIDFYRZ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | ITVIRNOCIDFYRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)