CAS 23975-63-5 is the registry number for 4,4,4-Trifluoro-1-(2-bromophenyl)-1,3-butanedione, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
1-(2-bromophenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 23975-63-5) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: 1-(2-bromophenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: GOHPFCXEXBKPLP-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 1-(2-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | GOHPFCXEXBKPLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)