Products 1980063-91-9
CAS 1980063-91-9 appears in our catalog under these names: 4-(Trifluoroacetyl)phenacyl bromide, 95%, 4-(Trifluoroacetyl)phenacyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-[4-(2-bromoacetyl)phenyl]-2,2,2-trifluoroethanone (CAS 1980063-91-9) is a chemical compound with the molecular formula C10H6BrF3O2 and a molecular weight of 295.05 g/mol. IUPAC name: 1-[4-(2-bromoacetyl)phenyl]-2,2,2-trifluoroethanone. InChIKey: FQZXFFWUMWFTRS-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | 1-[4-(2-bromoacetyl)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | FQZXFFWUMWFTRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)