Products 1260608-26-1
CAS 1260608-26-1 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)-2-(4-methoxybenzyl)propanoic acid, 98%, (S)-3-((tert-Butoxycarbonyl)amino)-2-(4-methoxybenzyl)propanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg.
(2S)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260608-26-1) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2S)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RZILVXJBADJFIP-LBPRGKRZSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2S)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RZILVXJBADJFIP-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)