Products 1260608-84-1
CAS 1260608-84-1 is the registry number for (R)-3-((tert-Butoxycarbonyl)amino)-2-(4-methoxybenzyl)propanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 100mg.
(2R)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1260608-84-1) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2R)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RZILVXJBADJFIP-GFCCVEGCSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2R)-2-[(4-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RZILVXJBADJFIP-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)