CAS 1260619-16-6 is the registry number for (R)–3–(3–Bromo–phenoxy)–pyrrolidine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 250mg, 50mg.
(3R)-3-(3-bromophenoxy)pyrrolidine;hydrochloride (CAS 1260619-16-6) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: (3R)-3-(3-bromophenoxy)pyrrolidine;hydrochloride. InChIKey: CBHYADKFFREZNK-HNCPQSOCSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | (3R)-3-(3-bromophenoxy)pyrrolidine;hydrochloride |
| InChIKey | CBHYADKFFREZNK-HNCPQSOCSA-N |
| SMILES | C1CNC[C@@H]1OC2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)