CAS 126062-18-8 is the registry number for (±)-Lobucavir. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one (CAS 126062-18-8) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one. InChIKey: GWFOVSGRNGAGDL-FSDSQADBSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | 2-amino-9-[(1R,2R,3S)-2,3-bis(hydroxymethyl)cyclobutyl]-1H-purin-6-one |
| InChIKey | GWFOVSGRNGAGDL-FSDSQADBSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]1N2C=NC3=C2N=C(NC3=O)N)CO)CO |
Computed by PubChem (NCBI)