Products 1260663-38-4
CAS 1260663-38-4 appears in our catalog under these names: 2,4,7-Trichloropyrido[3,2-d]pyrimidine, 98%, 98%, 2,4,7-TRICHLOROPYRIDO[3,2-D]PYRIMIDINE, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4,7-trichloropyrido[3,2-d]pyrimidine (CAS 1260663-38-4) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 2,4,7-trichloropyrido[3,2-d]pyrimidine. InChIKey: MLALFCICPSCTQF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 2,4,7-trichloropyrido[3,2-d]pyrimidine |
| InChIKey | MLALFCICPSCTQF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(N=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)