CAS 1260663-77-1 is the registry number for 5-Fluoro-2-(trifluoromethyl)pyridin-4-amine. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
5-fluoro-2-(trifluoromethyl)pyridin-4-amine (CAS 1260663-77-1) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethyl)pyridin-4-amine. InChIKey: UXLQUFVYDUXVTJ-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethyl)pyridin-4-amine |
| InChIKey | UXLQUFVYDUXVTJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)F)N |
Computed by PubChem (NCBI)