CAS 2993-07-9 appears in our catalog under these names: 3,4,5,6-Tetrafluorobenzene-1,2-diamine 95%, 3,4,5,6-Tetrafluorobenzene-1,2-diamine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,4,5,6-tetrafluorobenzene-1,2-diamine (CAS 2993-07-9) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 3,4,5,6-tetrafluorobenzene-1,2-diamine. InChIKey: PEMNTZYICNLRSQ-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 3,4,5,6-tetrafluorobenzene-1,2-diamine |
| InChIKey | PEMNTZYICNLRSQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)N)N |
Computed by PubChem (NCBI)