CAS 653-11-2 appears in our catalog under these names: 2,3,5,6-Tetrafluorophenylhydrazine 98%, 2,3,5,6-Tetrafluorophenylhydrazine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(2,3,5,6-tetrafluorophenyl)hydrazine (CAS 653-11-2) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: (2,3,5,6-tetrafluorophenyl)hydrazine. InChIKey: TYMFVEOXNZYYTF-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | (2,3,5,6-tetrafluorophenyl)hydrazine |
| InChIKey | TYMFVEOXNZYYTF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)NN)F)F |
Computed by PubChem (NCBI)