CAS 1198-64-7 appears in our catalog under these names: 2,3,5,6-Tetrafluoro-1,4-phenylenediamine, 95%, 2,3,5,6–Tetrafluorobenzene–1,4–diamine, 2,3,5,6-Tetrafluoro-1,4-phenylenediamine, >98.0%(GC)(T), 2,3,5,6-Tetrafluoro-1,4-phenylenediamine, 98%, 98%, 2,3,5,6-Tetrafluoro-1,4-phenylenediamine. Offered by: Combi-blocks, GLPBio, TCI, Chemat, HPC Standards. Available pack sizes: 250mg, 1g, 100mg, 5g, 1x100mg.
2,3,5,6-tetrafluorobenzene-1,4-diamine (CAS 1198-64-7) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzene-1,4-diamine. InChIKey: FVFYRXJKYAVFSB-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzene-1,4-diamine |
| InChIKey | FVFYRXJKYAVFSB-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)N |
Computed by PubChem (NCBI)