CAS 1198-63-6 appears in our catalog under these names: 3,4,5,6-Tetrafluorobenzene-1,2-diamine, 95%, 1,3-Diaminotetrafluorobenzene, 95%, 2,4,5,6–Tetrafluoro–1,3–phenylenediamine, 2,4,5,6-Tetrafluoro-1,3-phenylenediamine, >95.0%(GC), 2,4,5,6-Tetrafluorobenzene-1,3-diamine. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 200mg.
2,4,5,6-tetrafluorobenzene-1,3-diamine (CAS 1198-63-6) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 2,4,5,6-tetrafluorobenzene-1,3-diamine. InChIKey: FXGQUGCFZKMIJW-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 2,4,5,6-tetrafluorobenzene-1,3-diamine |
| InChIKey | FXGQUGCFZKMIJW-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)N)F)N |
Computed by PubChem (NCBI)