CAS 1806793-68-9 is the registry number for 4-(Difluoromethyl)-3,5-difluoropyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)-3,5-difluoropyridin-2-amine (CAS 1806793-68-9) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 4-(difluoromethyl)-3,5-difluoropyridin-2-amine. InChIKey: YXWSSTRSCPRSSA-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 4-(difluoromethyl)-3,5-difluoropyridin-2-amine |
| InChIKey | YXWSSTRSCPRSSA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)F)C(F)F)F |
Computed by PubChem (NCBI)