Products 1260664-89-8
CAS 1260664-89-8 appears in our catalog under these names: 1-(2,3-Difluorophenyl)cyclopropane-1-carboxylic acid, 1-(2,3-Difluorophenyl)cyclopropane-1-carboxylic acid, 97%, 97%, 1-(2,3-DIFLUOROPHENYL)CYCLOPROPANECARBOXYLIC ACID, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
1-(2,3-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 1260664-89-8) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: 1-(2,3-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: AZLLDERTVHHERM-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | AZLLDERTVHHERM-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C(=CC=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)