Products 1260758-24-4

CAS 1260758-24-4 is the registry number for Tacrolimus Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-acetamidoethylsulfanylcarbonyl)pent-4-enoic acid (CAS 1260758-24-4) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: 2-(2-acetamidoethylsulfanylcarbonyl)pent-4-enoic acid. InChIKey: RZPYMBXFOMWBNA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15NO4S
Molecular weight245.30 g/mol
IUPAC name2-(2-acetamidoethylsulfanylcarbonyl)pent-4-enoic acid
InChIKeyRZPYMBXFOMWBNA-UHFFFAOYSA-N
SMILESCC(=O)NCCSC(=O)C(CC=C)C(=O)O

Computed by PubChem (NCBI)