CAS 51458-28-7 is the registry number for Thiamphenicol Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol (CAS 51458-28-7) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: (1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol. InChIKey: CIAZEFCFQFQJLB-NXEZZACHSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | (1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol |
| InChIKey | CIAZEFCFQFQJLB-NXEZZACHSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)N)O |
Computed by PubChem (NCBI)