Products 51458-28-7

CAS 51458-28-7 is the registry number for Thiamphenicol Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol (CAS 51458-28-7) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: (1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol. InChIKey: CIAZEFCFQFQJLB-NXEZZACHSA-N.

Identity
Molecular formulaC10H15NO4S
Molecular weight245.30 g/mol
IUPAC name(1R,2R)-2-amino-1-(4-methylsulfonylphenyl)propane-1,3-diol
InChIKeyCIAZEFCFQFQJLB-NXEZZACHSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)N)O

Computed by PubChem (NCBI)