CAS 2169153-70-0 is the registry number for Apremilast Impurity 63. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1-amino-2-methylsulfonylethyl)-2-methoxyphenol (CAS 2169153-70-0) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: 5-(1-amino-2-methylsulfonylethyl)-2-methoxyphenol. InChIKey: OZRIMFCTUUSWPZ-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 5-(1-amino-2-methylsulfonylethyl)-2-methoxyphenol |
| InChIKey | OZRIMFCTUUSWPZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(CS(=O)(=O)C)N)O |
Computed by PubChem (NCBI)