CAS 890708-65-3 is the registry number for 5-((2R)-2-Aminopropyl)-2-methoxybenzenesulfonic Acid. Offered by: TRC. Available pack sizes: 500mg.
5-[(2R)-2-aminopropyl]-2-methoxybenzenesulfonic acid (CAS 890708-65-3) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: 5-[(2R)-2-aminopropyl]-2-methoxybenzenesulfonic acid. InChIKey: ZIDMEUOHWXPUFW-SSDOTTSWSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 5-[(2R)-2-aminopropyl]-2-methoxybenzenesulfonic acid |
| InChIKey | ZIDMEUOHWXPUFW-SSDOTTSWSA-N |
| SMILES | C[C@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)O)N |
Computed by PubChem (NCBI)