CAS 1396967-49-9 appears in our catalog under these names: Tamsulosin Impurity R, Tamsulosin Impurity 24, Tamsulosin Impurity 17. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(2-hydroxypropyl)-2-methoxybenzenesulfonamide (CAS 1396967-49-9) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: 5-(2-hydroxypropyl)-2-methoxybenzenesulfonamide. InChIKey: AGRCLHMPIDJPOX-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 5-(2-hydroxypropyl)-2-methoxybenzenesulfonamide |
| InChIKey | AGRCLHMPIDJPOX-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)OC)S(=O)(=O)N)O |
Computed by PubChem (NCBI)