CAS 13127-79-2 appears in our catalog under these names: N,N-Bis(2-hydroxyethyl)benzenesulfonamide, Levocetirizine Impurity 17. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, 1g, 500mg, on request.
N,N-bis(2-hydroxyethyl)benzenesulfonamide (CAS 13127-79-2) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: N,N-bis(2-hydroxyethyl)benzenesulfonamide. InChIKey: DQHSFCBOCSEJGK-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| InChIKey | DQHSFCBOCSEJGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(CCO)CCO |
Computed by PubChem (NCBI)