Products 1260761-81-6
CAS 1260761-81-6 appears in our catalog under these names: 1–(3–chloro–5–fluorophenyl)cyclopropan–1–amine hydrochloride, 1-(3-Chloro-5-fluorophenyl)cyclopropan-1-amine. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
1-(3-chloro-5-fluorophenyl)cyclopropan-1-amine (CAS 1260761-81-6) is a chemical compound with the molecular formula C9H9ClFN and a molecular weight of 185.62 g/mol. IUPAC name: 1-(3-chloro-5-fluorophenyl)cyclopropan-1-amine. InChIKey: DOEFOZXDZKKNCY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFN |
|---|---|
| Molecular weight | 185.62 g/mol |
| IUPAC name | 1-(3-chloro-5-fluorophenyl)cyclopropan-1-amine |
| InChIKey | DOEFOZXDZKKNCY-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC(=C2)Cl)F)N |
Computed by PubChem (NCBI)