CAS 1260791-59-0 appears in our catalog under these names: Methyl 5-aminomethyl-3-pyridine-carboxylate hydrochloride, 95%, Methyl 5–(aminomethyl)nicotinate hydrochloride, Methyl 5-(aminomethyl)nicotinate hydrochloride 97%, Methyl 5-(aminomethyl)nicotinate hydrochloride, 97%, 97%, Methyl 5-(aminomethyl)nicotinate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
Methyl 5-(aminomethyl)pyridine-3-carboxylate;hydrochloride (CAS 1260791-59-0) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 5-(aminomethyl)pyridine-3-carboxylate;hydrochloride. InChIKey: NGPLNUJIHBDBCR-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 5-(aminomethyl)pyridine-3-carboxylate;hydrochloride |
| InChIKey | NGPLNUJIHBDBCR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)