CAS 1260795-33-2 is the registry number for 5-(2-Bromophenyl)oxazol-2-amine 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-(2-bromophenyl)-1,3-oxazol-2-amine (CAS 1260795-33-2) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 5-(2-bromophenyl)-1,3-oxazol-2-amine. InChIKey: WREFEDQTTRWFRM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1,3-oxazol-2-amine |
| InChIKey | WREFEDQTTRWFRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(O2)N)Br |
Computed by PubChem (NCBI)