CAS 1260798-68-2 is the registry number for 1–(4–chloro–2–fluorophenyl)cyclobutane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 1260798-68-2) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: NTMSIWRMNUANHT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | NTMSIWRMNUANHT-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=C(C=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)