Products 1260900-12-6
CAS 1260900-12-6 appears in our catalog under these names: 1-(2-Chloro-4-fluorophenyl)cyclobutane-1-carboxylic acid, 97%, 97%, 1-(2-CHLORO-4-FLUOROPHENYL)CYCLOBUTANECARBOXYLIC ACID, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 1g.
1-(2-chloro-4-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 1260900-12-6) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: 1-(2-chloro-4-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: YFQUMKGMXGMINF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 1-(2-chloro-4-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | YFQUMKGMXGMINF-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=C(C=C2)F)Cl)C(=O)O |
Computed by PubChem (NCBI)