Products 1315560-52-1
CAS 1315560-52-1 appears in our catalog under these names: trans–ethyl–3–(2–chloro–6–fluorophenyl)acrylate, trans-ethyl-3-(2-chloro-6-fluorophenyl)acrylate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
Ethyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (CAS 1315560-52-1) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: ethyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate. InChIKey: VWGCPKIKIFYTOR-VOTSOKGWSA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | ethyl (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| InChIKey | VWGCPKIKIFYTOR-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=CC=C1Cl)F |
Computed by PubChem (NCBI)