CAS 1260826-90-1 appears in our catalog under these names: 1-(2,5-Difluorophenyl)cyclopentane-1-carboxylic acid, 1-(2,5-Difluorophenyl)cyclopentane-1-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(2,5-difluorophenyl)cyclopentane-1-carboxylic acid (CAS 1260826-90-1) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 1-(2,5-difluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: ARSUDDLYOOYHRN-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | ARSUDDLYOOYHRN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)