Products 2648588-83-2

CAS 2648588-83-2 is the registry number for 3-Cyclopropyl-5-(1,1-difluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid (CAS 2648588-83-2) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid. InChIKey: USPDVFOPYYFCMI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F2O2
Molecular weight226.22 g/mol
IUPAC name3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid
InChIKeyUSPDVFOPYYFCMI-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC(=C1)C(=O)O)C2CC2)(F)F

Computed by PubChem (NCBI)