CAS 2648588-83-2 is the registry number for 3-Cyclopropyl-5-(1,1-difluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid (CAS 2648588-83-2) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid. InChIKey: USPDVFOPYYFCMI-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 3-cyclopropyl-5-(1,1-difluoroethyl)benzoic acid |
| InChIKey | USPDVFOPYYFCMI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(=O)O)C2CC2)(F)F |
Computed by PubChem (NCBI)